C10H12F3N3OS — CID 134118831
1-(2-methoxyphenyl)-3-(2,2,2-trifluoroethylamino)thiourea (PubChem CID 134118831) has the molecular formula C10H12F3N3OS and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(2,2,2-trifluoroethylamino)thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-(2,2,2-trifluoroethylamino)thiourea |
|---|---|
| PubChem CID | 134118831 |
| Molecular Formula | C10H12F3N3OS |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(2,2,2-trifluoroethylamino)thiourea |
| SMILES | COc1ccccc1NC(=S)NNCC(F)(F)F |
| InChI | InChI=1S/C10H12F3N3OS/c1-17-8-5-3-2-4-7(8)15-9(18)16-14-6-10(11,12)13/h2-5,14H,6H2,1H3,(H2,15,16,18) |
| InChIKey | KRPFXQMNRCQAPP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|