C9H9ClF3N3S — CID 134100877
1-(2-chlorophenyl)-3-(2,2,2-trifluoroethylamino)thiourea (PubChem CID 134100877) has the molecular formula C9H9ClF3N3S and a molecular weight of 283.71 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(2,2,2-trifluoroethylamino)thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-(2,2,2-trifluoroethylamino)thiourea |
|---|---|
| PubChem CID | 134100877 |
| Molecular Formula | C9H9ClF3N3S |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(2,2,2-trifluoroethylamino)thiourea |
| SMILES | FC(F)(F)CNNC(=S)Nc1ccccc1Cl |
| InChI | InChI=1S/C9H9ClF3N3S/c10-6-3-1-2-4-7(6)15-8(17)16-14-5-9(11,12)13/h1-4,14H,5H2,(H2,15,16,17) |
| InChIKey | MEAVMQRBACGUJW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|