C21H29N2O8P — CID 21210724
N-[diethoxyphosphoryl-(3,4,5-trimethoxyphenyl)methyl]-4-methyl-3-nitroaniline (PubChem CID 21210724) has the molecular formula C21H29N2O8P and a molecular weight of 468.44 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-(3,4,5-trimethoxyphenyl)methyl]-4-methyl-3-nitroaniline.
| Compound Name | N-[diethoxyphosphoryl-(3,4,5-trimethoxyphenyl)methyl]-4-methyl-3-nitroaniline |
|---|---|
| PubChem CID | 21210724 |
| Molecular Formula | C21H29N2O8P |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-[diethoxyphosphoryl-(3,4,5-trimethoxyphenyl)methyl]-4-methyl-3-nitroaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc(C)c([N+](=O)[O-])c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H29N2O8P/c1-7-30-32(26,31-8-2)21(22-16-10-9-14(3)17(13-16)23(24)25)15-11-18(27-4)20(29-6)19(12-15)28-5/h9-13,21-22H,7-8H2,1-6H3 |
| InChIKey | KFTYEYOGFUHHTJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|