C20H27N2O7P — CID 21210928
N-[diethoxyphosphoryl-(2,4-dimethoxyphenyl)methyl]-2-methyl-4-nitroaniline (PubChem CID 21210928) has the molecular formula C20H27N2O7P and a molecular weight of 438.42 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-(2,4-dimethoxyphenyl)methyl]-2-methyl-4-nitroaniline.
| Compound Name | N-[diethoxyphosphoryl-(2,4-dimethoxyphenyl)methyl]-2-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 21210928 |
| Molecular Formula | C20H27N2O7P |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[diethoxyphosphoryl-(2,4-dimethoxyphenyl)methyl]-2-methyl-4-nitroaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc([N+](=O)[O-])cc1C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C20H27N2O7P/c1-6-28-30(25,29-7-2)20(17-10-9-16(26-4)13-19(17)27-5)21-18-11-8-15(22(23)24)12-14(18)3/h8-13,20-21H,6-7H2,1-5H3 |
| InChIKey | KKYOIYORHAMDEW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|