C24H36NO6P — CID 4672682
N-[dibutoxyphosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline (PubChem CID 4672682) has the molecular formula C24H36NO6P and a molecular weight of 465.53 g/mol. Its IUPAC name is N-[dibutoxyphosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline.
| Compound Name | N-[dibutoxyphosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 4672682 |
| Molecular Formula | C24H36NO6P |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | N-[dibutoxyphosphoryl-(3,4,5-trimethoxyphenyl)methyl]aniline |
| SMILES | CCCCOP(=O)(OCCCC)C(Nc1ccccc1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H36NO6P/c1-6-8-15-30-32(26,31-16-9-7-2)24(25-20-13-11-10-12-14-20)19-17-21(27-3)23(29-5)22(18-19)28-4/h10-14,17-18,24-25H,6-9,15-16H2,1-5H3 |
| InChIKey | RZMWJODGZOBLGK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|