C25H30NO5PS — CID 71816642
N-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-2-phenylsulfanylaniline (PubChem CID 71816642) has the molecular formula C25H30NO5PS and a molecular weight of 487.56 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-2-phenylsulfanylaniline.
| Compound Name | N-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-2-phenylsulfanylaniline |
|---|---|
| PubChem CID | 71816642 |
| Molecular Formula | C25H30NO5PS |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-2-phenylsulfanylaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccccc1Sc1ccccc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H30NO5PS/c1-5-30-32(27,31-6-2)25(19-16-17-22(28-3)23(18-19)29-4)26-21-14-10-11-15-24(21)33-20-12-8-7-9-13-20/h7-18,25-26H,5-6H2,1-4H3 |
| InChIKey | YENPZMNZLQAWHA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|