C23H34NO3P — CID 100986575
N-[dipentoxyphosphoryl(phenyl)methyl]aniline (PubChem CID 100986575) has the molecular formula C23H34NO3P and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[dipentoxyphosphoryl(phenyl)methyl]aniline.
| Compound Name | N-[dipentoxyphosphoryl(phenyl)methyl]aniline |
|---|---|
| PubChem CID | 100986575 |
| Molecular Formula | C23H34NO3P |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[dipentoxyphosphoryl(phenyl)methyl]aniline |
| SMILES | CCCCCOP(=O)(OCCCCC)C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H34NO3P/c1-3-5-13-19-26-28(25,27-20-14-6-4-2)23(21-15-9-7-10-16-21)24-22-17-11-8-12-18-22/h7-12,15-18,23-24H,3-6,13-14,19-20H2,1-2H3 |
| InChIKey | XMSZMMYLKYNAIP-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|