C18H24NO2P — CID 3573903
N-[[methyl(2-methylpropoxy)phosphoryl]-phenylmethyl]aniline (PubChem CID 3573903) has the molecular formula C18H24NO2P and a molecular weight of 317.37 g/mol. Its IUPAC name is N-[[methyl(2-methylpropoxy)phosphoryl]-phenylmethyl]aniline.
| Compound Name | N-[[methyl(2-methylpropoxy)phosphoryl]-phenylmethyl]aniline |
|---|---|
| PubChem CID | 3573903 |
| Molecular Formula | C18H24NO2P |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[[methyl(2-methylpropoxy)phosphoryl]-phenylmethyl]aniline |
| SMILES | CC(C)COP(C)(=O)C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24NO2P/c1-15(2)14-21-22(3,20)18(16-10-6-4-7-11-16)19-17-12-8-5-9-13-17/h4-13,15,18-19H,14H2,1-3H3 |
| InChIKey | LUYKXRPZBOHDSH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|