C14H24NO3P — CID 3065120
N-[bis(2-methylpropoxy)phosphoryl]aniline (PubChem CID 3065120) has the molecular formula C14H24NO3P and a molecular weight of 285.32 g/mol. Its IUPAC name is N-[bis(2-methylpropoxy)phosphoryl]aniline.
| Compound Name | N-[bis(2-methylpropoxy)phosphoryl]aniline |
|---|---|
| PubChem CID | 3065120 |
| Molecular Formula | C14H24NO3P |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[bis(2-methylpropoxy)phosphoryl]aniline |
| SMILES | CC(C)COP(=O)(Nc1ccccc1)OCC(C)C |
| InChI | InChI=1S/C14H24NO3P/c1-12(2)10-17-19(16,18-11-13(3)4)15-14-8-6-5-7-9-14/h5-9,12-13H,10-11H2,1-4H3,(H,15,16) |
| InChIKey | YTXJKISHOJJDOK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|