C18H24NOPS — CID 11862895
N-[(S)-[methyl(2-methylpropoxy)phosphinothioyl]-phenylmethyl]aniline (PubChem CID 11862895) has the molecular formula C18H24NOPS and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[(S)-[methyl(2-methylpropoxy)phosphinothioyl]-phenylmethyl]aniline.
| Compound Name | N-[(S)-[methyl(2-methylpropoxy)phosphinothioyl]-phenylmethyl]aniline |
|---|---|
| PubChem CID | 11862895 |
| Molecular Formula | C18H24NOPS |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[(S)-[methyl(2-methylpropoxy)phosphinothioyl]-phenylmethyl]aniline |
| SMILES | CC(C)CO[P@@](C)(=S)[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24NOPS/c1-15(2)14-20-21(3,22)18(16-10-6-4-7-11-16)19-17-12-8-5-9-13-17/h4-13,15,18-19H,14H2,1-3H3/t18-,21-/m0/s1 |
| InChIKey | WDWVIWIUPJZKAT-RXVVDRJESA-N |
| XLogP | 5.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|