C22H30NO5P — CID 71393489
4-[[[hydroxy(octoxy)phosphoryl]-phenylmethyl]amino]benzoic acid (PubChem CID 71393489) has the molecular formula C22H30NO5P and a molecular weight of 419.46 g/mol. Its IUPAC name is 4-[[[hydroxy(octoxy)phosphoryl]-phenylmethyl]amino]benzoic acid.
| Compound Name | 4-[[[hydroxy(octoxy)phosphoryl]-phenylmethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 71393489 |
| Molecular Formula | C22H30NO5P |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 4-[[[hydroxy(octoxy)phosphoryl]-phenylmethyl]amino]benzoic acid |
| SMILES | CCCCCCCCOP(=O)(O)C(Nc1ccc(C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H30NO5P/c1-2-3-4-5-6-10-17-28-29(26,27)21(18-11-8-7-9-12-18)23-20-15-13-19(14-16-20)22(24)25/h7-9,11-16,21,23H,2-6,10,17H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | MNCUOMZGXCVOIB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|