C39H56O4 — CID 165052058
butan-2-ylbenzene;4-butan-2-ylbenzoic acid;heptyl 4-butan-2-ylbenzoate (PubChem CID 165052058) has the molecular formula C39H56O4 and a molecular weight of 588.87 g/mol. Its IUPAC name is butan-2-ylbenzene;4-butan-2-ylbenzoic acid;heptyl 4-butan-2-ylbenzoate.
| Compound Name | butan-2-ylbenzene;4-butan-2-ylbenzoic acid;heptyl 4-butan-2-ylbenzoate |
|---|---|
| PubChem CID | 165052058 |
| Molecular Formula | C39H56O4 |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 588.42 |
| IUPAC Name | butan-2-ylbenzene;4-butan-2-ylbenzoic acid;heptyl 4-butan-2-ylbenzoate |
| SMILES | CCC(C)c1ccc(C(=O)O)cc1.CCC(C)c1ccccc1.CCCCCCCOC(=O)c1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C18H28O2.C11H14O2.C10H14/c1-4-6-7-8-9-14-20-18(19)17-12-10-16(11-13-17)15(3)5-2;1-3-8(2)9-4-6-10(7-5-9)11(12)13;1-3-9(2)10-7-5-4-6-8-10/h10-13,15H,4-9,14H2,1-3H3;4-8H,3H2,1-2H3,(H,12,13);4-9H,3H2,1-2H3 |
| InChIKey | PUVMQILYQHRGSH-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|