C22H28ClF3NO4PS — CID 21210780
4-(2-chloro-1,1,2-trifluoroethoxy)-N-[di(propan-2-yloxy)phosphoryl-(4-methylsulfanylphenyl)methyl]aniline (PubChem CID 21210780) has the molecular formula C22H28ClF3NO4PS and a molecular weight of 525.96 g/mol. Its IUPAC name is 4-(2-chloro-1,1,2-trifluoroethoxy)-N-[di(propan-2-yloxy)phosphoryl-(4-methylsulfanylphenyl)methyl]aniline.
| Compound Name | 4-(2-chloro-1,1,2-trifluoroethoxy)-N-[di(propan-2-yloxy)phosphoryl-(4-methylsulfanylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 21210780 |
| Molecular Formula | C22H28ClF3NO4PS |
| Molecular Weight | 525.96 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 4-(2-chloro-1,1,2-trifluoroethoxy)-N-[di(propan-2-yloxy)phosphoryl-(4-methylsulfanylphenyl)methyl]aniline |
| SMILES | CSc1ccc(C(Nc2ccc(OC(F)(F)C(F)Cl)cc2)P(=O)(OC(C)C)OC(C)C)cc1 |
| InChI | InChI=1S/C22H28ClF3NO4PS/c1-14(2)30-32(28,31-15(3)4)20(16-6-12-19(33-5)13-7-16)27-17-8-10-18(11-9-17)29-22(25,26)21(23)24/h6-15,20-21,27H,1-5H3 |
| InChIKey | GAYKMDPTKGBETR-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.96 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|