C20H28N3O6P — CID 95091760
4-N-[(S)-di(propan-2-yloxy)phosphoryl-(4-methoxyphenyl)methyl]-2-nitrobenzene-1,4-diamine (PubChem CID 95091760) has the molecular formula C20H28N3O6P and a molecular weight of 437.43 g/mol. Its IUPAC name is 4-N-[(S)-di(propan-2-yloxy)phosphoryl-(4-methoxyphenyl)methyl]-2-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-[(S)-di(propan-2-yloxy)phosphoryl-(4-methoxyphenyl)methyl]-2-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 95091760 |
| Molecular Formula | C20H28N3O6P |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 4-N-[(S)-di(propan-2-yloxy)phosphoryl-(4-methoxyphenyl)methyl]-2-nitrobenzene-1,4-diamine |
| SMILES | COc1ccc([C@@H](Nc2ccc(N)c([N+](=O)[O-])c2)P(=O)(OC(C)C)OC(C)C)cc1 |
| InChI | InChI=1S/C20H28N3O6P/c1-13(2)28-30(26,29-14(3)4)20(15-6-9-17(27-5)10-7-15)22-16-8-11-18(21)19(12-16)23(24)25/h6-14,20,22H,21H2,1-5H3/t20-/m0/s1 |
| InChIKey | CUNMYKRVYKXTTA-FQEVSTJZSA-N |
| XLogP | 5.34 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|