C10H15N3O2 — CID 163875157
4-N-[(2S)-butan-2-yl]-2-nitrobenzene-1,4-diamine (PubChem CID 163875157) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-N-[(2S)-butan-2-yl]-2-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-[(2S)-butan-2-yl]-2-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 163875157 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-N-[(2S)-butan-2-yl]-2-nitrobenzene-1,4-diamine |
| SMILES | CC[C@H](C)Nc1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H15N3O2/c1-3-7(2)12-8-4-5-9(11)10(6-8)13(14)15/h4-7,12H,3,11H2,1-2H3/t7-/m0/s1 |
| InChIKey | POGDERIGNBCRHT-ZETCQYMHSA-N |
| XLogP | 2.39 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|