C17H16F6NO3P — CID 11575500
N-[dimethoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)aniline (PubChem CID 11575500) has the molecular formula C17H16F6NO3P and a molecular weight of 427.28 g/mol. Its IUPAC name is N-[dimethoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)aniline.
| Compound Name | N-[dimethoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 11575500 |
| Molecular Formula | C17H16F6NO3P |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-[dimethoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)aniline |
| SMILES | COP(=O)(OC)C(Nc1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F6NO3P/c1-26-28(25,27-2)15(11-3-5-12(6-4-11)16(18,19)20)24-14-9-7-13(8-10-14)17(21,22)23/h3-10,15,24H,1-2H3 |
| InChIKey | NWYOLAXONZLNHJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|