C13H18F3NO2 — CID 79492862
N-ethyl-2,2-dimethoxy-1-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 79492862) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is N-ethyl-2,2-dimethoxy-1-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-ethyl-2,2-dimethoxy-1-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 79492862 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-ethyl-2,2-dimethoxy-1-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CCNC(c1ccc(C(F)(F)F)cc1)C(OC)OC |
| InChI | InChI=1S/C13H18F3NO2/c1-4-17-11(12(18-2)19-3)9-5-7-10(8-6-9)13(14,15)16/h5-8,11-12,17H,4H2,1-3H3 |
| InChIKey | UAVIRCJAKCYXEE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|