C30H26F6N2O2 — CID 46223762
(1R,2R)-N,N'-bis(4-methoxyphenyl)-1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 46223762) has the molecular formula C30H26F6N2O2 and a molecular weight of 560.54 g/mol. Its IUPAC name is (1R,2R)-N,N'-bis(4-methoxyphenyl)-1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | (1R,2R)-N,N'-bis(4-methoxyphenyl)-1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 46223762 |
| Molecular Formula | C30H26F6N2O2 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | (1R,2R)-N,N'-bis(4-methoxyphenyl)-1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | COc1ccc(N[C@H](c2ccc(C(F)(F)F)cc2)[C@H](Nc2ccc(OC)cc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H26F6N2O2/c1-39-25-15-11-23(12-16-25)37-27(19-3-7-21(8-4-19)29(31,32)33)28(38-24-13-17-26(40-2)18-14-24)20-5-9-22(10-6-20)30(34,35)36/h3-18,27-28,37-38H,1-2H3/t27-,28-/m1/s1 |
| InChIKey | QWANGFCIHDYFPI-VSGBNLITSA-N |
| XLogP | 8.75 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|