C22H18F3NO3S — CID 11133829
4-methoxy-N-[(S)-[(2R,3S)-3-oxo-1,3λ4-benzoxathiol-2-yl]-[4-(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 11133829) has the molecular formula C22H18F3NO3S and a molecular weight of 433.45 g/mol. Its IUPAC name is 4-methoxy-N-[(S)-[(2R,3S)-3-oxo-1,3λ4-benzoxathiol-2-yl]-[4-(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | 4-methoxy-N-[(S)-[(2R,3S)-3-oxo-1,3λ4-benzoxathiol-2-yl]-[4-(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 11133829 |
| Molecular Formula | C22H18F3NO3S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 4-methoxy-N-[(S)-[(2R,3S)-3-oxo-1,3λ4-benzoxathiol-2-yl]-[4-(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | COc1ccc(N[C@@H](c2ccc(C(F)(F)F)cc2)[C@@H]2Oc3ccccc3[S@@]2=O)cc1 |
| InChI | InChI=1S/C22H18F3NO3S/c1-28-17-12-10-16(11-13-17)26-20(14-6-8-15(9-7-14)22(23,24)25)21-29-18-4-2-3-5-19(18)30(21)27/h2-13,20-21,26H,1H3/t20-,21+,30-/m0/s1 |
| InChIKey | APPQBMMCXCOSDA-NOUQMAPCSA-N |
| XLogP | 5.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|