C24H26N2O2S — CID 102406083
4-[(R)-(4-methoxyanilino)-[(2S)-1-oxo-2,3-dihydro-1-benzothiophen-2-yl]methyl]-N,N-dimethylaniline (PubChem CID 102406083) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 4-[(R)-(4-methoxyanilino)-[(2S)-1-oxo-2,3-dihydro-1-benzothiophen-2-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(R)-(4-methoxyanilino)-[(2S)-1-oxo-2,3-dihydro-1-benzothiophen-2-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102406083 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 4-[(R)-(4-methoxyanilino)-[(2S)-1-oxo-2,3-dihydro-1-benzothiophen-2-yl]methyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(N[C@H](c2ccc(N(C)C)cc2)[C@@H]2Cc3ccccc3S2=O)cc1 |
| InChI | InChI=1S/C24H26N2O2S/c1-26(2)20-12-8-17(9-13-20)24(25-19-10-14-21(28-3)15-11-19)23-16-18-6-4-5-7-22(18)29(23)27/h4-15,23-25H,16H2,1-3H3/t23-,24+,29?/m0/s1 |
| InChIKey | RPVXNAHPOZLJTR-FEMHNBHWSA-N |
| XLogP | 4.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|