C24H26N2O3 — CID 71490438
N-[(R)-[(2S)-5,6-dimethoxy-2,3-dihydro-1H-indol-2-yl]-phenylmethyl]-4-methoxyaniline (PubChem CID 71490438) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[(R)-[(2S)-5,6-dimethoxy-2,3-dihydro-1H-indol-2-yl]-phenylmethyl]-4-methoxyaniline.
| Compound Name | N-[(R)-[(2S)-5,6-dimethoxy-2,3-dihydro-1H-indol-2-yl]-phenylmethyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 71490438 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[(R)-[(2S)-5,6-dimethoxy-2,3-dihydro-1H-indol-2-yl]-phenylmethyl]-4-methoxyaniline |
| SMILES | COc1ccc(N[C@H](c2ccccc2)[C@@H]2Cc3cc(OC)c(OC)cc3N2)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-27-19-11-9-18(10-12-19)25-24(16-7-5-4-6-8-16)21-13-17-14-22(28-2)23(29-3)15-20(17)26-21/h4-12,14-15,21,24-26H,13H2,1-3H3/t21-,24+/m0/s1 |
| InChIKey | WKLKEXQBSAVBBD-XUZZJYLKSA-N |
| XLogP | 4.90 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|