C20H20N2O2 — CID 71490211
N-[(S)-[(2S)-2,3-dihydro-1H-indol-2-yl]-(furan-2-yl)methyl]-4-methoxyaniline (PubChem CID 71490211) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[(S)-[(2S)-2,3-dihydro-1H-indol-2-yl]-(furan-2-yl)methyl]-4-methoxyaniline.
| Compound Name | N-[(S)-[(2S)-2,3-dihydro-1H-indol-2-yl]-(furan-2-yl)methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 71490211 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[(S)-[(2S)-2,3-dihydro-1H-indol-2-yl]-(furan-2-yl)methyl]-4-methoxyaniline |
| SMILES | COc1ccc(N[C@H](c2ccco2)[C@@H]2Cc3ccccc3N2)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-23-16-10-8-15(9-11-16)21-20(19-7-4-12-24-19)18-13-14-5-2-3-6-17(14)22-18/h2-12,18,20-22H,13H2,1H3/t18-,20-/m0/s1 |
| InChIKey | BGLHRSIRCWTDCN-ICSRJNTNSA-N |
| XLogP | 4.48 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|