C22H24N2O4 — CID 53231596
N-[(1R,2R,3R)-3-(furan-2-yl)-2-nitro-1-phenylpentyl]-4-methoxyaniline (PubChem CID 53231596) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[(1R,2R,3R)-3-(furan-2-yl)-2-nitro-1-phenylpentyl]-4-methoxyaniline.
| Compound Name | N-[(1R,2R,3R)-3-(furan-2-yl)-2-nitro-1-phenylpentyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 53231596 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[(1R,2R,3R)-3-(furan-2-yl)-2-nitro-1-phenylpentyl]-4-methoxyaniline |
| SMILES | CC[C@@H](c1ccco1)[C@H]([C@H](Nc1ccc(OC)cc1)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N2O4/c1-3-19(20-10-7-15-28-20)22(24(25)26)21(16-8-5-4-6-9-16)23-17-11-13-18(27-2)14-12-17/h4-15,19,21-23H,3H2,1-2H3/t19-,21+,22+/m0/s1 |
| InChIKey | SBMHLYIHLPHEMR-KSEOMHKRSA-N |
| XLogP | 5.28 |
| TPSA | 77.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|