C24H26N2O3 — CID 53231711
4-methoxy-N-[(1R,2R,3R)-2-nitro-1,3-diphenylpentyl]aniline (PubChem CID 53231711) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-methoxy-N-[(1R,2R,3R)-2-nitro-1,3-diphenylpentyl]aniline.
| Compound Name | 4-methoxy-N-[(1R,2R,3R)-2-nitro-1,3-diphenylpentyl]aniline |
|---|---|
| PubChem CID | 53231711 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-methoxy-N-[(1R,2R,3R)-2-nitro-1,3-diphenylpentyl]aniline |
| SMILES | CC[C@H](c1ccccc1)[C@H]([C@H](Nc1ccc(OC)cc1)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C24H26N2O3/c1-3-22(18-10-6-4-7-11-18)24(26(27)28)23(19-12-8-5-9-13-19)25-20-14-16-21(29-2)17-15-20/h4-17,22-25H,3H2,1-2H3/t22-,23-,24-/m1/s1 |
| InChIKey | ILKJPTJCLAEWSN-WXFUMESZSA-N |
| XLogP | 5.69 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|