C26H25F3N2O4 — CID 53231276
2,2,2-trifluoro-N-(4-methoxyphenyl)-N-[(1R,2S,3R)-2-nitro-1,3-diphenylpentyl]acetamide (PubChem CID 53231276) has the molecular formula C26H25F3N2O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-methoxyphenyl)-N-[(1R,2S,3R)-2-nitro-1,3-diphenylpentyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-(4-methoxyphenyl)-N-[(1R,2S,3R)-2-nitro-1,3-diphenylpentyl]acetamide |
|---|---|
| PubChem CID | 53231276 |
| Molecular Formula | C26H25F3N2O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-methoxyphenyl)-N-[(1R,2S,3R)-2-nitro-1,3-diphenylpentyl]acetamide |
| SMILES | CC[C@H](c1ccccc1)[C@@H]([C@@H](c1ccccc1)N(C(=O)C(F)(F)F)c1ccc(OC)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C26H25F3N2O4/c1-3-22(18-10-6-4-7-11-18)24(31(33)34)23(19-12-8-5-9-13-19)30(25(32)26(27,28)29)20-14-16-21(35-2)17-15-20/h4-17,22-24H,3H2,1-2H3/t22-,23-,24+/m1/s1 |
| InChIKey | JHHGCQPYXLMOKM-SMIHKQSGSA-N |
| XLogP | 6.17 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|