C27H26BrF3N2O7 — CID 71489646
N-[(1R,2S)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(2-methoxyphenyl)-2-nitropropyl]-2,2,2-trifluoro-N-(4-methoxyphenyl)acetamide (PubChem CID 71489646) has the molecular formula C27H26BrF3N2O7 and a molecular weight of 627.41 g/mol. Its IUPAC name is N-[(1R,2S)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(2-methoxyphenyl)-2-nitropropyl]-2,2,2-trifluoro-N-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(1R,2S)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(2-methoxyphenyl)-2-nitropropyl]-2,2,2-trifluoro-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 71489646 |
| Molecular Formula | C27H26BrF3N2O7 |
| Molecular Weight | 627.41 g/mol |
| Exact Mass | 626.09 |
| IUPAC Name | N-[(1R,2S)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(2-methoxyphenyl)-2-nitropropyl]-2,2,2-trifluoro-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(N(C(=O)C(F)(F)F)[C@H](c2ccccc2OC)[C@H](Cc2cc(OC)c(OC)cc2Br)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H26BrF3N2O7/c1-37-18-11-9-17(10-12-18)32(26(34)27(29,30)31)25(19-7-5-6-8-22(19)38-2)21(33(35)36)13-16-14-23(39-3)24(40-4)15-20(16)28/h5-12,14-15,21,25H,13H2,1-4H3/t21-,25+/m0/s1 |
| InChIKey | RMFRHPCLWDKALI-SQJMNOBHSA-N |
| XLogP | 6.01 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.41 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|