C19H21BrN2O4 — CID 132581879
2-(2-bromo-4-nitrophenyl)-N,N-diethyl-2-(2-methoxyphenyl)acetamide (PubChem CID 132581879) has the molecular formula C19H21BrN2O4 and a molecular weight of 421.29 g/mol. Its IUPAC name is 2-(2-bromo-4-nitrophenyl)-N,N-diethyl-2-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(2-bromo-4-nitrophenyl)-N,N-diethyl-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 132581879 |
| Molecular Formula | C19H21BrN2O4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2-(2-bromo-4-nitrophenyl)-N,N-diethyl-2-(2-methoxyphenyl)acetamide |
| SMILES | CCN(CC)C(=O)C(c1ccc([N+](=O)[O-])cc1Br)c1ccccc1OC |
| InChI | InChI=1S/C19H21BrN2O4/c1-4-21(5-2)19(23)18(15-8-6-7-9-17(15)26-3)14-11-10-13(22(24)25)12-16(14)20/h6-12,18H,4-5H2,1-3H3 |
| InChIKey | APENGFOZLNBFFA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|