C18H17BrN2O6 — CID 55862096
N-[1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-2-methoxy-5-nitrobenzamide (PubChem CID 55862096) has the molecular formula C18H17BrN2O6 and a molecular weight of 437.25 g/mol. Its IUPAC name is N-[1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-2-methoxy-5-nitrobenzamide.
| Compound Name | N-[1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-2-methoxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 55862096 |
| Molecular Formula | C18H17BrN2O6 |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | N-[1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-2-methoxy-5-nitrobenzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)NC(C)c1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C18H17BrN2O6/c1-10(12-8-16-17(9-14(12)19)27-6-5-26-16)20-18(22)13-7-11(21(23)24)3-4-15(13)25-2/h3-4,7-10H,5-6H2,1-2H3,(H,20,22) |
| InChIKey | QISJBTLHMYRIJR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|