C23H23BrN2O4 — CID 71489112
N-[(1R,2S)-3-(2-bromophenyl)-1-(2-methoxyphenyl)-2-nitropropyl]-4-methoxyaniline (PubChem CID 71489112) has the molecular formula C23H23BrN2O4 and a molecular weight of 471.35 g/mol. Its IUPAC name is N-[(1R,2S)-3-(2-bromophenyl)-1-(2-methoxyphenyl)-2-nitropropyl]-4-methoxyaniline.
| Compound Name | N-[(1R,2S)-3-(2-bromophenyl)-1-(2-methoxyphenyl)-2-nitropropyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 71489112 |
| Molecular Formula | C23H23BrN2O4 |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[(1R,2S)-3-(2-bromophenyl)-1-(2-methoxyphenyl)-2-nitropropyl]-4-methoxyaniline |
| SMILES | COc1ccc(N[C@H](c2ccccc2OC)[C@H](Cc2ccccc2Br)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H23BrN2O4/c1-29-18-13-11-17(12-14-18)25-23(19-8-4-6-10-22(19)30-2)21(26(27)28)15-16-7-3-5-9-20(16)24/h3-14,21,23,25H,15H2,1-2H3/t21-,23+/m0/s1 |
| InChIKey | MPEZDMVNXHOUBO-JTHBVZDNSA-N |
| XLogP | 5.51 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|