C23H23FN2O3 — CID 59051313
(1S,2R)-3-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]-2-nitro-1-phenylpropan-1-amine (PubChem CID 59051313) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is (1S,2R)-3-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]-2-nitro-1-phenylpropan-1-amine.
| Compound Name | (1S,2R)-3-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]-2-nitro-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 59051313 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (1S,2R)-3-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]-2-nitro-1-phenylpropan-1-amine |
| SMILES | COc1ccccc1CN[C@@H](c1ccccc1)[C@@H](Cc1ccc(F)cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C23H23FN2O3/c1-29-22-10-6-5-9-19(22)16-25-23(18-7-3-2-4-8-18)21(26(27)28)15-17-11-13-20(24)14-12-17/h2-14,21,23,25H,15-16H2,1H3/t21-,23+/m1/s1 |
| InChIKey | LGWRVBZDNDLHKH-GGAORHGYSA-N |
| XLogP | 4.55 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|