C15H17ClFNO — CID 17292771
1-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]methanamine;hydrochloride (PubChem CID 17292771) has the molecular formula C15H17ClFNO and a molecular weight of 281.76 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]methanamine;hydrochloride.
| Compound Name | 1-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 17292771 |
| Molecular Formula | C15H17ClFNO |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]methanamine;hydrochloride |
| SMILES | COc1ccccc1CNCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C15H16FNO.ClH/c1-18-15-5-3-2-4-13(15)11-17-10-12-6-8-14(16)9-7-12;/h2-9,17H,10-11H2,1H3;1H |
| InChIKey | VERBQQQDJOPUEW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |