C19H28Cl2N2O — CID 17208220
N,N-diethyl-4-[[(2-methoxyphenyl)methylamino]methyl]aniline;dihydrochloride (PubChem CID 17208220) has the molecular formula C19H28Cl2N2O and a molecular weight of 371.35 g/mol. Its IUPAC name is N,N-diethyl-4-[[(2-methoxyphenyl)methylamino]methyl]aniline;dihydrochloride.
| Compound Name | N,N-diethyl-4-[[(2-methoxyphenyl)methylamino]methyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 17208220 |
| Molecular Formula | C19H28Cl2N2O |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N,N-diethyl-4-[[(2-methoxyphenyl)methylamino]methyl]aniline;dihydrochloride |
| SMILES | CCN(CC)c1ccc(CNCc2ccccc2OC)cc1.Cl.Cl |
| InChI | InChI=1S/C19H26N2O.2ClH/c1-4-21(5-2)18-12-10-16(11-13-18)14-20-15-17-8-6-7-9-19(17)22-3;;/h6-13,20H,4-5,14-15H2,1-3H3;2*1H |
| InChIKey | VDWKSHVWTMKMCJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|