C18H20N2O2 — CID 59053233
(1S,2R)-2-nitro-1,3-diphenyl-N-prop-2-enylpropan-1-amine (PubChem CID 59053233) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (1S,2R)-2-nitro-1,3-diphenyl-N-prop-2-enylpropan-1-amine.
| Compound Name | (1S,2R)-2-nitro-1,3-diphenyl-N-prop-2-enylpropan-1-amine |
|---|---|
| PubChem CID | 59053233 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (1S,2R)-2-nitro-1,3-diphenyl-N-prop-2-enylpropan-1-amine |
| SMILES | C=CCN[C@@H](c1ccccc1)[C@@H](Cc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O2/c1-2-13-19-18(16-11-7-4-8-12-16)17(20(21)22)14-15-9-5-3-6-10-15/h2-12,17-19H,1,13-14H2/t17-,18+/m1/s1 |
| InChIKey | IBYDGIHMDCEEQP-MSOLQXFVSA-N |
| XLogP | 3.39 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|