C28H28N2O2 — CID 12543528
(1S,2R)-1,2-bis(2-methoxyphenyl)-N,N'-diphenylethane-1,2-diamine (PubChem CID 12543528) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is (1S,2R)-1,2-bis(2-methoxyphenyl)-N,N'-diphenylethane-1,2-diamine.
| Compound Name | (1S,2R)-1,2-bis(2-methoxyphenyl)-N,N'-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 12543528 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (1S,2R)-1,2-bis(2-methoxyphenyl)-N,N'-diphenylethane-1,2-diamine |
| SMILES | COc1ccccc1[C@@H](Nc1ccccc1)[C@@H](Nc1ccccc1)c1ccccc1OC |
| InChI | InChI=1S/C28H28N2O2/c1-31-25-19-11-9-17-23(25)27(29-21-13-5-3-6-14-21)28(30-22-15-7-4-8-16-22)24-18-10-12-20-26(24)32-2/h3-20,27-30H,1-2H3/t27-,28+ |
| InChIKey | GYTLEZCAAVVMBB-HNRBIFIRSA-N |
| XLogP | 6.71 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |