C10H16N2O — CID 116954416
1-(2-methoxyphenyl)-N,N'-dimethylmethanediamine (PubChem CID 116954416) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-N,N'-dimethylmethanediamine.
| Compound Name | 1-(2-methoxyphenyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 116954416 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(2-methoxyphenyl)-N,N'-dimethylmethanediamine |
| SMILES | CNC(NC)c1ccccc1OC |
| InChI | InChI=1S/C10H16N2O/c1-11-10(12-2)8-6-4-5-7-9(8)13-3/h4-7,10-12H,1-3H3 |
| InChIKey | GRHGEYCNZKQHRI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|