C30H29BrN2O5 — CID 71489322
N-[(1R,2S)-3-(2-bromo-4-methoxy-3-phenylmethoxyphenyl)-2-nitro-1-phenylpropyl]-4-methoxyaniline (PubChem CID 71489322) has the molecular formula C30H29BrN2O5 and a molecular weight of 577.48 g/mol. Its IUPAC name is N-[(1R,2S)-3-(2-bromo-4-methoxy-3-phenylmethoxyphenyl)-2-nitro-1-phenylpropyl]-4-methoxyaniline.
| Compound Name | N-[(1R,2S)-3-(2-bromo-4-methoxy-3-phenylmethoxyphenyl)-2-nitro-1-phenylpropyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 71489322 |
| Molecular Formula | C30H29BrN2O5 |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | N-[(1R,2S)-3-(2-bromo-4-methoxy-3-phenylmethoxyphenyl)-2-nitro-1-phenylpropyl]-4-methoxyaniline |
| SMILES | COc1ccc(N[C@H](c2ccccc2)[C@H](Cc2ccc(OC)c(OCc3ccccc3)c2Br)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H29BrN2O5/c1-36-25-16-14-24(15-17-25)32-29(22-11-7-4-8-12-22)26(33(34)35)19-23-13-18-27(37-2)30(28(23)31)38-20-21-9-5-3-6-10-21/h3-18,26,29,32H,19-20H2,1-2H3/t26-,29+/m0/s1 |
| InChIKey | XTONKSAUGBNMGO-LITSAYRRSA-N |
| XLogP | 7.09 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|