C19H23NO3 — CID 100975098
ethyl (2S,3R)-3-(4-methoxyanilino)-2-methyl-3-phenylpropanoate (PubChem CID 100975098) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is ethyl (2S,3R)-3-(4-methoxyanilino)-2-methyl-3-phenylpropanoate.
| Compound Name | ethyl (2S,3R)-3-(4-methoxyanilino)-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 100975098 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | ethyl (2S,3R)-3-(4-methoxyanilino)-2-methyl-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H](C)[C@@H](Nc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO3/c1-4-23-19(21)14(2)18(15-8-6-5-7-9-15)20-16-10-12-17(22-3)13-11-16/h5-14,18,20H,4H2,1-3H3/t14-,18+/m0/s1 |
| InChIKey | IJHJJRKPSGAQFX-KBXCAEBGSA-N |
| XLogP | 4.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|