C23H25NO2 — CID 101373003
(1R,2S,3S)-3-(4-methoxyanilino)-2-methyl-1,3-diphenylpropan-1-ol (PubChem CID 101373003) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (1R,2S,3S)-3-(4-methoxyanilino)-2-methyl-1,3-diphenylpropan-1-ol.
| Compound Name | (1R,2S,3S)-3-(4-methoxyanilino)-2-methyl-1,3-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 101373003 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (1R,2S,3S)-3-(4-methoxyanilino)-2-methyl-1,3-diphenylpropan-1-ol |
| SMILES | COc1ccc(N[C@H](c2ccccc2)[C@H](C)[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO2/c1-17(23(25)19-11-7-4-8-12-19)22(18-9-5-3-6-10-18)24-20-13-15-21(26-2)16-14-20/h3-17,22-25H,1-2H3/t17-,22-,23+/m0/s1 |
| InChIKey | WELYWCDVKBLDTC-PDIWNELESA-N |
| XLogP | 5.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|