C19H21NO — CID 71606353
(2R,3R)-2-(4-methoxyphenyl)-3-prop-1-en-2-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 71606353) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (2R,3R)-2-(4-methoxyphenyl)-3-prop-1-en-2-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R,3R)-2-(4-methoxyphenyl)-3-prop-1-en-2-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 71606353 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (2R,3R)-2-(4-methoxyphenyl)-3-prop-1-en-2-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | C=C(C)[C@H]1Cc2ccccc2N[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H21NO/c1-13(2)17-12-15-6-4-5-7-18(15)20-19(17)14-8-10-16(21-3)11-9-14/h4-11,17,19-20H,1,12H2,2-3H3/t17-,19+/m1/s1 |
| InChIKey | HJRXZAUENZNQSN-MJGOQNOKSA-N |
| XLogP | 4.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|