C21H27NOSi — CID 135034725
[(E,3S)-3-[(2S)-5-methoxy-2,3-dihydro-1H-indol-2-yl]-3-phenylprop-1-enyl]-trimethylsilane (PubChem CID 135034725) has the molecular formula C21H27NOSi and a molecular weight of 337.54 g/mol. Its IUPAC name is [(E,3S)-3-[(2S)-5-methoxy-2,3-dihydro-1H-indol-2-yl]-3-phenylprop-1-enyl]-trimethylsilane.
| Compound Name | [(E,3S)-3-[(2S)-5-methoxy-2,3-dihydro-1H-indol-2-yl]-3-phenylprop-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 135034725 |
| Molecular Formula | C21H27NOSi |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [(E,3S)-3-[(2S)-5-methoxy-2,3-dihydro-1H-indol-2-yl]-3-phenylprop-1-enyl]-trimethylsilane |
| SMILES | COc1ccc2c(c1)C[C@@H]([C@@H](/C=C/[Si](C)(C)C)c1ccccc1)N2 |
| InChI | InChI=1S/C21H27NOSi/c1-23-18-10-11-20-17(14-18)15-21(22-20)19(12-13-24(2,3)4)16-8-6-5-7-9-16/h5-14,19,21-22H,15H2,1-4H3/b13-12+/t19-,21-/m0/s1 |
| InChIKey | HVMSEJCFRXCFPH-LMULYTEMSA-N |
| XLogP | 5.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|