C12H17NO — CID 131025344
(2S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinoline (PubChem CID 131025344) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (2S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 131025344 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinoline |
| SMILES | CC[C@H]1CCc2cc(OC)ccc2N1 |
| InChI | InChI=1S/C12H17NO/c1-3-10-5-4-9-8-11(14-2)6-7-12(9)13-10/h6-8,10,13H,3-5H2,1-2H3/t10-/m0/s1 |
| InChIKey | NPPNZZCXZJPEIA-JTQLQIEISA-N |
| XLogP | 2.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|