C11H14ClNO3 — CID 70503014
6-methoxy-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride (PubChem CID 70503014) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride.
| Compound Name | 6-methoxy-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70503014 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 6-methoxy-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride |
| SMILES | COc1ccc2c(c1)CCC(C(=O)O)N2.Cl |
| InChI | InChI=1S/C11H13NO3.ClH/c1-15-8-3-5-9-7(6-8)2-4-10(12-9)11(13)14;/h3,5-6,10,12H,2,4H2,1H3,(H,13,14);1H |
| InChIKey | ACJNIYDXIVOTQE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|