C17H15F2N — CID 135034586
(2S)-5-fluoro-2-[(1S)-1-(3-fluorophenyl)prop-2-enyl]-2,3-dihydro-1H-indole (PubChem CID 135034586) has the molecular formula C17H15F2N and a molecular weight of 271.31 g/mol. Its IUPAC name is (2S)-5-fluoro-2-[(1S)-1-(3-fluorophenyl)prop-2-enyl]-2,3-dihydro-1H-indole.
| Compound Name | (2S)-5-fluoro-2-[(1S)-1-(3-fluorophenyl)prop-2-enyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 135034586 |
| Molecular Formula | C17H15F2N |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (2S)-5-fluoro-2-[(1S)-1-(3-fluorophenyl)prop-2-enyl]-2,3-dihydro-1H-indole |
| SMILES | C=C[C@@H](c1cccc(F)c1)[C@@H]1Cc2cc(F)ccc2N1 |
| InChI | InChI=1S/C17H15F2N/c1-2-15(11-4-3-5-13(18)8-11)17-10-12-9-14(19)6-7-16(12)20-17/h2-9,15,17,20H,1,10H2/t15-,17-/m0/s1 |
| InChIKey | YPWQBPWUVBQHEO-RDJZCZTQSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|