C19H17NO3S2 — CID 101208191
4-methoxy-N-[(S)-[(2R)-3-oxo-1,3λ4-benzoxathiol-2-yl]-thiophen-2-ylmethyl]aniline (PubChem CID 101208191) has the molecular formula C19H17NO3S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 4-methoxy-N-[(S)-[(2R)-3-oxo-1,3λ4-benzoxathiol-2-yl]-thiophen-2-ylmethyl]aniline.
| Compound Name | 4-methoxy-N-[(S)-[(2R)-3-oxo-1,3λ4-benzoxathiol-2-yl]-thiophen-2-ylmethyl]aniline |
|---|---|
| PubChem CID | 101208191 |
| Molecular Formula | C19H17NO3S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 4-methoxy-N-[(S)-[(2R)-3-oxo-1,3λ4-benzoxathiol-2-yl]-thiophen-2-ylmethyl]aniline |
| SMILES | COc1ccc(N[C@@H](c2cccs2)[C@@H]2Oc3ccccc3S2=O)cc1 |
| InChI | InChI=1S/C19H17NO3S2/c1-22-14-10-8-13(9-11-14)20-18(16-6-4-12-24-16)19-23-15-5-2-3-7-17(15)25(19)21/h2-12,18-20H,1H3/t18-,19+,25?/m0/s1 |
| InChIKey | MZNYPIZDXWNCHQ-HPLQXTBUSA-N |
| XLogP | 4.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|