C24H23NO2S — CID 102195292
2-[(S)-(4-methoxyanilino)-thiophen-2-ylmethyl]-4,4-dimethyl-3-phenylcyclobut-2-en-1-one (PubChem CID 102195292) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-[(S)-(4-methoxyanilino)-thiophen-2-ylmethyl]-4,4-dimethyl-3-phenylcyclobut-2-en-1-one.
| Compound Name | 2-[(S)-(4-methoxyanilino)-thiophen-2-ylmethyl]-4,4-dimethyl-3-phenylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 102195292 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[(S)-(4-methoxyanilino)-thiophen-2-ylmethyl]-4,4-dimethyl-3-phenylcyclobut-2-en-1-one |
| SMILES | COc1ccc(N[C@@H](C2=C(c3ccccc3)C(C)(C)C2=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H23NO2S/c1-24(2)21(16-8-5-4-6-9-16)20(23(24)26)22(19-10-7-15-28-19)25-17-11-13-18(27-3)14-12-17/h4-15,22,25H,1-3H3/t22-/m1/s1 |
| InChIKey | LWSJPRSFRVNAQN-JOCHJYFZSA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|