C18H23NO5S2 — CID 134161844
2,5-dimethoxy-N-[oxan-4-yl(thiophen-2-yl)methyl]benzenesulfonamide (PubChem CID 134161844) has the molecular formula C18H23NO5S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[oxan-4-yl(thiophen-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[oxan-4-yl(thiophen-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134161844 |
| Molecular Formula | C18H23NO5S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2,5-dimethoxy-N-[oxan-4-yl(thiophen-2-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NC(c2cccs2)C2CCOCC2)c1 |
| InChI | InChI=1S/C18H23NO5S2/c1-22-14-5-6-15(23-2)17(12-14)26(20,21)19-18(16-4-3-11-25-16)13-7-9-24-10-8-13/h3-6,11-13,18-19H,7-10H2,1-2H3 |
| InChIKey | WGNFHSWAOAQVFZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |