C20H25NO2S — CID 126855328
2,4,6-trimethyl-N-[oxan-4-yl(thiophen-2-yl)methyl]benzamide (PubChem CID 126855328) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[oxan-4-yl(thiophen-2-yl)methyl]benzamide.
| Compound Name | 2,4,6-trimethyl-N-[oxan-4-yl(thiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 126855328 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2,4,6-trimethyl-N-[oxan-4-yl(thiophen-2-yl)methyl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)NC(c2cccs2)C2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C20H25NO2S/c1-13-11-14(2)18(15(3)12-13)20(22)21-19(17-5-4-10-24-17)16-6-8-23-9-7-16/h4-5,10-12,16,19H,6-9H2,1-3H3,(H,21,22) |
| InChIKey | AJCPCICBJZCCLL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |