C14H16N2O2S2 — CID 126853665
N-[oxan-4-yl(thiophen-2-yl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 126853665) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is N-[oxan-4-yl(thiophen-2-yl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[oxan-4-yl(thiophen-2-yl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 126853665 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-[oxan-4-yl(thiophen-2-yl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC(c1cccs1)C1CCOCC1)c1cscn1 |
| InChI | InChI=1S/C14H16N2O2S2/c17-14(11-8-19-9-15-11)16-13(12-2-1-7-20-12)10-3-5-18-6-4-10/h1-2,7-10,13H,3-6H2,(H,16,17) |
| InChIKey | LFJISKYDMZKCSZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |