C17H20FNOS — CID 43775939
N-[cyclopentyl(thiophen-2-yl)methyl]-3-fluoro-4-methoxyaniline (PubChem CID 43775939) has the molecular formula C17H20FNOS and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]-3-fluoro-4-methoxyaniline.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]-3-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 43775939 |
| Molecular Formula | C17H20FNOS |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]-3-fluoro-4-methoxyaniline |
| SMILES | COc1ccc(NC(c2cccs2)C2CCCC2)cc1F |
| InChI | InChI=1S/C17H20FNOS/c1-20-15-9-8-13(11-14(15)18)19-17(12-5-2-3-6-12)16-7-4-10-21-16/h4,7-12,17,19H,2-3,5-6H2,1H3 |
| InChIKey | QSJBNYTVMMEQEN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|