C15H16FNS — CID 79055355
N-[cyclopropyl(thiophen-2-yl)methyl]-3-fluoro-5-methylaniline (PubChem CID 79055355) has the molecular formula C15H16FNS and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[cyclopropyl(thiophen-2-yl)methyl]-3-fluoro-5-methylaniline.
| Compound Name | N-[cyclopropyl(thiophen-2-yl)methyl]-3-fluoro-5-methylaniline |
|---|---|
| PubChem CID | 79055355 |
| Molecular Formula | C15H16FNS |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-[cyclopropyl(thiophen-2-yl)methyl]-3-fluoro-5-methylaniline |
| SMILES | Cc1cc(F)cc(NC(c2cccs2)C2CC2)c1 |
| InChI | InChI=1S/C15H16FNS/c1-10-7-12(16)9-13(8-10)17-15(11-4-5-11)14-3-2-6-18-14/h2-3,6-9,11,15,17H,4-5H2,1H3 |
| InChIKey | GGNKLRGUXWLEPC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |